C17H34O8 — CID 91614471
3,4,5,6-tetrahydroxy-1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]hexan-2-one (PubChem CID 91614471) has the molecular formula C17H34O8 and a molecular weight of 366.45 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]hexan-2-one.
| Compound Name | 3,4,5,6-tetrahydroxy-1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]hexan-2-one |
|---|---|
| PubChem CID | 91614471 |
| Molecular Formula | C17H34O8 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]hexan-2-one |
| SMILES | COC(C)(C)CCOC(C)(C)CCOCC(=O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C17H34O8/c1-16(2,23-5)7-9-25-17(3,4)6-8-24-11-13(20)15(22)14(21)12(19)10-18/h12,14-15,18-19,21-22H,6-11H2,1-5H3 |
| InChIKey | YJNFZXIPXDYFER-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|