C19H39NO7 — CID 177057712
4-(2,4-dimethylpentan-2-yloxy)-2,2-dimethyl-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide (PubChem CID 177057712) has the molecular formula C19H39NO7 and a molecular weight of 393.52 g/mol. Its IUPAC name is 4-(2,4-dimethylpentan-2-yloxy)-2,2-dimethyl-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide.
| Compound Name | 4-(2,4-dimethylpentan-2-yloxy)-2,2-dimethyl-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide |
|---|---|
| PubChem CID | 177057712 |
| Molecular Formula | C19H39NO7 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 4-(2,4-dimethylpentan-2-yloxy)-2,2-dimethyl-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide |
| SMILES | CC(C)CC(C)(C)OCCC(C)(C)C(=O)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C19H39NO7/c1-12(2)9-19(5,6)27-8-7-18(3,4)17(26)20-10-13(22)15(24)16(25)14(23)11-21/h12-16,21-25H,7-11H2,1-6H3,(H,20,26) |
| InChIKey | HWDDQXSQMFKWGT-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |