C21H44N2O2 — CID 134174558
N-[2-(tert-butylamino)ethyl]-2,2-dimethyl-4-(2,5,5-trimethylhexan-2-yloxy)butanamide (PubChem CID 134174558) has the molecular formula C21H44N2O2 and a molecular weight of 356.60 g/mol. Its IUPAC name is N-[2-(tert-butylamino)ethyl]-2,2-dimethyl-4-(2,5,5-trimethylhexan-2-yloxy)butanamide.
| Compound Name | N-[2-(tert-butylamino)ethyl]-2,2-dimethyl-4-(2,5,5-trimethylhexan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 134174558 |
| Molecular Formula | C21H44N2O2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | N-[2-(tert-butylamino)ethyl]-2,2-dimethyl-4-(2,5,5-trimethylhexan-2-yloxy)butanamide |
| SMILES | CC(C)(C)CCC(C)(C)OCCC(C)(C)C(=O)NCCNC(C)(C)C |
| InChI | InChI=1S/C21H44N2O2/c1-18(2,3)11-12-21(9,10)25-16-13-20(7,8)17(24)22-14-15-23-19(4,5)6/h23H,11-16H2,1-10H3,(H,22,24) |
| InChIKey | CGLZLAKNRDNFTD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|