C13H27NO3S — CID 130266058
2,2,5,5-tetramethyl-N-(2-methylsulfonylethyl)hexanamide (PubChem CID 130266058) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-(2-methylsulfonylethyl)hexanamide.
| Compound Name | 2,2,5,5-tetramethyl-N-(2-methylsulfonylethyl)hexanamide |
|---|---|
| PubChem CID | 130266058 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-(2-methylsulfonylethyl)hexanamide |
| SMILES | CC(C)(C)CCC(C)(C)C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C13H27NO3S/c1-12(2,3)7-8-13(4,5)11(15)14-9-10-18(6,16)17/h7-10H2,1-6H3,(H,14,15) |
| InChIKey | RWAXRZQMDQFEEU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |