C9H19NO8S — CID 145336912
2,2,6,6,6-pentahydroxy-N-(2-methylsulfonylethyl)hexanamide (PubChem CID 145336912) has the molecular formula C9H19NO8S and a molecular weight of 301.32 g/mol. Its IUPAC name is 2,2,6,6,6-pentahydroxy-N-(2-methylsulfonylethyl)hexanamide.
| Compound Name | 2,2,6,6,6-pentahydroxy-N-(2-methylsulfonylethyl)hexanamide |
|---|---|
| PubChem CID | 145336912 |
| Molecular Formula | C9H19NO8S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2,2,6,6,6-pentahydroxy-N-(2-methylsulfonylethyl)hexanamide |
| SMILES | CS(=O)(=O)CCNC(=O)C(O)(O)CCCC(O)(O)O |
| InChI | InChI=1S/C9H19NO8S/c1-19(17,18)6-5-10-7(11)8(12,13)3-2-4-9(14,15)16/h12-16H,2-6H2,1H3,(H,10,11) |
| InChIKey | AUXSRHRKVJTTJO-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|