C11H19NO5S — CID 63784503
4-(2-methylsulfonylethylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 63784503) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is 4-(2-methylsulfonylethylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(2-methylsulfonylethylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63784503 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-(2-methylsulfonylethylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | CS(=O)(=O)CCNC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H19NO5S/c1-18(16,17)7-6-12-10(13)8-2-4-9(5-3-8)11(14)15/h8-9H,2-7H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | DDSRNVYUZQGTRG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |