C20H41NO4 — CID 168959673
4-(2,5-dimethyl-4-oxohexan-2-yl)oxy-2,2-dimethyl-N-pentylbutanamide;methanol (PubChem CID 168959673) has the molecular formula C20H41NO4 and a molecular weight of 359.55 g/mol. Its IUPAC name is 4-(2,5-dimethyl-4-oxohexan-2-yl)oxy-2,2-dimethyl-N-pentylbutanamide;methanol.
| Compound Name | 4-(2,5-dimethyl-4-oxohexan-2-yl)oxy-2,2-dimethyl-N-pentylbutanamide;methanol |
|---|---|
| PubChem CID | 168959673 |
| Molecular Formula | C20H41NO4 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | 4-(2,5-dimethyl-4-oxohexan-2-yl)oxy-2,2-dimethyl-N-pentylbutanamide;methanol |
| SMILES | CCCCCNC(=O)C(C)(C)CCOC(C)(C)CC(=O)C(C)C.CO |
| InChI | InChI=1S/C19H37NO3.CH4O/c1-8-9-10-12-20-17(22)18(4,5)11-13-23-19(6,7)14-16(21)15(2)3;1-2/h15H,8-14H2,1-7H3,(H,20,22);2H,1H3 |
| InChIKey | DNGWPSUVTSNCRX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|