C22H48N4O8 — CID 170110685
N-[3-[4-[3-amino-2,2-bis(aminomethyl)propoxy]-3,3-dimethylbutoxy]-3-methylbutyl]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 170110685) has the molecular formula C22H48N4O8 and a molecular weight of 496.65 g/mol. Its IUPAC name is N-[3-[4-[3-amino-2,2-bis(aminomethyl)propoxy]-3,3-dimethylbutoxy]-3-methylbutyl]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-[3-[4-[3-amino-2,2-bis(aminomethyl)propoxy]-3,3-dimethylbutoxy]-3-methylbutyl]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 170110685 |
| Molecular Formula | C22H48N4O8 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | N-[3-[4-[3-amino-2,2-bis(aminomethyl)propoxy]-3,3-dimethylbutoxy]-3-methylbutyl]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CC(C)(CCOC(C)(C)CCNC(=O)C(O)C(O)C(O)C(O)CO)COCC(CN)(CN)CN |
| InChI | InChI=1S/C22H48N4O8/c1-20(2,13-33-14-22(10-23,11-24)12-25)6-8-34-21(3,4)5-7-26-19(32)18(31)17(30)16(29)15(28)9-27/h15-18,27-31H,5-14,23-25H2,1-4H3,(H,26,32) |
| InChIKey | XKBDSNIRFCNQNO-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 226.77 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |