C23H48N4O18 — CID 59005262
N-[2-(aminomethyl)-2-[(2,3,4,5,6-pentahydroxyhexanoylamino)methyl]-3-(1,2,3,4,5-pentahydroxypentoxymethylamino)propyl]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 59005262) has the molecular formula C23H48N4O18 and a molecular weight of 668.65 g/mol. Its IUPAC name is N-[2-(aminomethyl)-2-[(2,3,4,5,6-pentahydroxyhexanoylamino)methyl]-3-(1,2,3,4,5-pentahydroxypentoxymethylamino)propyl]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-[2-(aminomethyl)-2-[(2,3,4,5,6-pentahydroxyhexanoylamino)methyl]-3-(1,2,3,4,5-pentahydroxypentoxymethylamino)propyl]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 59005262 |
| Molecular Formula | C23H48N4O18 |
| Molecular Weight | 668.65 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | N-[2-(aminomethyl)-2-[(2,3,4,5,6-pentahydroxyhexanoylamino)methyl]-3-(1,2,3,4,5-pentahydroxypentoxymethylamino)propyl]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | NCC(CNCOC(O)C(O)C(O)C(O)CO)(CNC(=O)C(O)C(O)C(O)C(O)CO)CNC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C23H48N4O18/c24-4-23(5-25-8-45-22(44)19(41)14(36)11(33)3-30,6-26-20(42)17(39)15(37)12(34)9(31)1-28)7-27-21(43)18(40)16(38)13(35)10(32)2-29/h9-19,22,25,28-41,44H,1-8,24H2,(H,26,42)(H,27,43) |
| InChIKey | JPQPYTKSLJHQFV-UHFFFAOYSA-N |
| XLogP | -12.01 |
| TPSA | 408.93 Ų |
| H-Bond Donors | 19 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.65 |
| LogP ≤ 5 | -12.01 |
| H-Bond Donors ≤ 5 | 19 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|