C16H35N3O3 — CID 155721213
N-[3-(3-acetamido-3-methylbutoxy)-3-aminobutyl]propanamide;ethane (PubChem CID 155721213) has the molecular formula C16H35N3O3 and a molecular weight of 317.47 g/mol. Its IUPAC name is N-[3-(3-acetamido-3-methylbutoxy)-3-aminobutyl]propanamide;ethane.
| Compound Name | N-[3-(3-acetamido-3-methylbutoxy)-3-aminobutyl]propanamide;ethane |
|---|---|
| PubChem CID | 155721213 |
| Molecular Formula | C16H35N3O3 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N-[3-(3-acetamido-3-methylbutoxy)-3-aminobutyl]propanamide;ethane |
| SMILES | CC.CCC(=O)NCCC(C)(N)OCCC(C)(C)NC(C)=O |
| InChI | InChI=1S/C14H29N3O3.C2H6/c1-6-12(19)16-9-7-14(5,15)20-10-8-13(3,4)17-11(2)18;1-2/h6-10,15H2,1-5H3,(H,16,19)(H,17,18);1-2H3 |
| InChIKey | MINKVEXRCSGXMW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|