C13H26O3P+ — CID 160575374
methane;methyl-oxo-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl)oxyphosphanium (PubChem CID 160575374) has the molecular formula C13H26O3P+ and a molecular weight of 261.32 g/mol. Its IUPAC name is methane;methyl-oxo-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl)oxyphosphanium.
| Compound Name | methane;methyl-oxo-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl)oxyphosphanium |
|---|---|
| PubChem CID | 160575374 |
| Molecular Formula | C13H26O3P+ |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | methane;methyl-oxo-(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl)oxyphosphanium |
| SMILES | C.C=C(C)C(=O)CC(C)(C)C(C)(C)O[P+](C)=O |
| InChI | InChI=1S/C12H22O3P.CH4/c1-9(2)10(13)8-11(3,4)12(5,6)15-16(7)14;/h1,8H2,2-7H3;1H4/q+1; |
| InChIKey | VBUPBSKIVKKUAC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|