C24H34O9 — CID 140507495
4-hydroxy-4-[1-[1-(4-hydroxy-2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-yl)oxyethoxy]ethoxy]-2,7-dimethylocta-1,7-diene-3,6-dione (PubChem CID 140507495) has the molecular formula C24H34O9 and a molecular weight of 466.53 g/mol. Its IUPAC name is 4-hydroxy-4-[1-[1-(4-hydroxy-2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-yl)oxyethoxy]ethoxy]-2,7-dimethylocta-1,7-diene-3,6-dione.
| Compound Name | 4-hydroxy-4-[1-[1-(4-hydroxy-2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-yl)oxyethoxy]ethoxy]-2,7-dimethylocta-1,7-diene-3,6-dione |
|---|---|
| PubChem CID | 140507495 |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 4-hydroxy-4-[1-[1-(4-hydroxy-2,7-dimethyl-3,6-dioxoocta-1,7-dien-4-yl)oxyethoxy]ethoxy]-2,7-dimethylocta-1,7-diene-3,6-dione |
| SMILES | C=C(C)C(=O)CC(O)(OC(C)OC(C)OC(O)(CC(=O)C(=C)C)C(=O)C(=C)C)C(=O)C(=C)C |
| InChI | InChI=1S/C24H34O9/c1-13(2)19(25)11-23(29,21(27)15(5)6)32-17(9)31-18(10)33-24(30,22(28)16(7)8)12-20(26)14(3)4/h17-18,29-30H,1,3,5,7,11-12H2,2,4,6,8-10H3 |
| InChIKey | XBJOHPXBHQWBTJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|