C17H21O7P — CID 140579129
(4-hydroxy-2,8-dimethyl-3,7-dioxonona-1,8-dien-4-yl) phenyl hydrogen phosphate (PubChem CID 140579129) has the molecular formula C17H21O7P and a molecular weight of 368.32 g/mol. Its IUPAC name is (4-hydroxy-2,8-dimethyl-3,7-dioxonona-1,8-dien-4-yl) phenyl hydrogen phosphate.
| Compound Name | (4-hydroxy-2,8-dimethyl-3,7-dioxonona-1,8-dien-4-yl) phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 140579129 |
| Molecular Formula | C17H21O7P |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (4-hydroxy-2,8-dimethyl-3,7-dioxonona-1,8-dien-4-yl) phenyl hydrogen phosphate |
| SMILES | C=C(C)C(=O)CCC(O)(OP(=O)(O)Oc1ccccc1)C(=O)C(=C)C |
| InChI | InChI=1S/C17H21O7P/c1-12(2)15(18)10-11-17(20,16(19)13(3)4)24-25(21,22)23-14-8-6-5-7-9-14/h5-9,20H,1,3,10-11H2,2,4H3,(H,21,22) |
| InChIKey | RWOFMAFKGSGWEP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|