About pentan-3-yl phenyl hydrogen phosphate
pentan-3-yl phenyl hydrogen phosphate (PubChem CID 175461995) has the molecular formula C11H17O4P
and a molecular weight of 244.23 g/mol. Its IUPAC name is pentan-3-yl phenyl hydrogen phosphate.
Molecular Properties
| Compound Name | pentan-3-yl phenyl hydrogen phosphate |
| PubChem CID | 175461995 |
| Molecular Formula | C11H17O4P |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | pentan-3-yl phenyl hydrogen phosphate |
| SMILES | CCC(CC)OP(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C11H17O4P/c1-3-10(4-2)14-16(12,13)15-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | FZZPABQKOWZRIV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-yl phenyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl phenyl hydrogen phosphate?
The IUPAC name of pentan-3-yl phenyl hydrogen phosphate (CID 175461995) is pentan-3-yl phenyl hydrogen phosphate.
What is the SMILES notation for pentan-3-yl phenyl hydrogen phosphate?
The canonical SMILES for pentan-3-yl phenyl hydrogen phosphate is CCC(CC)OP(=O)(O)Oc1ccccc1.
What is the InChIKey of pentan-3-yl phenyl hydrogen phosphate?
The InChIKey is FZZPABQKOWZRIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17O4P/c1-3-10(4-2)14-16(12,13)15-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H,12,13).
What are the key properties of pentan-3-yl phenyl hydrogen phosphate?
pentan-3-yl phenyl hydrogen phosphate has a molecular weight of 244.23 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl phenyl hydrogen phosphate is sourced from PubChem (CID 175461995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).