C23H25O7P — CID 139899071
(4-hydroxy-2,5,7-trimethyl-3,6-dioxoocta-1,7-dien-4-yl) diphenyl phosphate (PubChem CID 139899071) has the molecular formula C23H25O7P and a molecular weight of 444.42 g/mol. Its IUPAC name is (4-hydroxy-2,5,7-trimethyl-3,6-dioxoocta-1,7-dien-4-yl) diphenyl phosphate.
| Compound Name | (4-hydroxy-2,5,7-trimethyl-3,6-dioxoocta-1,7-dien-4-yl) diphenyl phosphate |
|---|---|
| PubChem CID | 139899071 |
| Molecular Formula | C23H25O7P |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (4-hydroxy-2,5,7-trimethyl-3,6-dioxoocta-1,7-dien-4-yl) diphenyl phosphate |
| SMILES | C=C(C)C(=O)C(C)C(O)(OP(=O)(Oc1ccccc1)Oc1ccccc1)C(=O)C(=C)C |
| InChI | InChI=1S/C23H25O7P/c1-16(2)21(24)18(5)23(26,22(25)17(3)4)30-31(27,28-19-12-8-6-9-13-19)29-20-14-10-7-11-15-20/h6-15,18,26H,1,3H2,2,4-5H3 |
| InChIKey | PHAXKCFAPZWXSU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|