C15H21O4P — CID 20683854
3-[[methyl(phenoxy)phosphoryl]methyl]heptane-2,6-dione (PubChem CID 20683854) has the molecular formula C15H21O4P and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-[[methyl(phenoxy)phosphoryl]methyl]heptane-2,6-dione.
| Compound Name | 3-[[methyl(phenoxy)phosphoryl]methyl]heptane-2,6-dione |
|---|---|
| PubChem CID | 20683854 |
| Molecular Formula | C15H21O4P |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[[methyl(phenoxy)phosphoryl]methyl]heptane-2,6-dione |
| SMILES | CC(=O)CCC(CP(C)(=O)Oc1ccccc1)C(C)=O |
| InChI | InChI=1S/C15H21O4P/c1-12(16)9-10-14(13(2)17)11-20(3,18)19-15-7-5-4-6-8-15/h4-8,14H,9-11H2,1-3H3 |
| InChIKey | OGMROKZBXZEVCE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|