C11H20O2 — CID 134235849
6-hydroxy-2,5,5,6-tetramethylhept-1-en-3-one (PubChem CID 134235849) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 6-hydroxy-2,5,5,6-tetramethylhept-1-en-3-one.
| Compound Name | 6-hydroxy-2,5,5,6-tetramethylhept-1-en-3-one |
|---|---|
| PubChem CID | 134235849 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 6-hydroxy-2,5,5,6-tetramethylhept-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C11H20O2/c1-8(2)9(12)7-10(3,4)11(5,6)13/h13H,1,7H2,2-6H3 |
| InChIKey | ZMWCIZNVOVDDBP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|