C17H18F12O2 — CID 154475501
6,6,6-trifluoro-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-methyl-5-(trifluoromethyl)hex-1-en-3-one (PubChem CID 154475501) has the molecular formula C17H18F12O2 and a molecular weight of 482.31 g/mol. Its IUPAC name is 6,6,6-trifluoro-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-methyl-5-(trifluoromethyl)hex-1-en-3-one.
| Compound Name | 6,6,6-trifluoro-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-methyl-5-(trifluoromethyl)hex-1-en-3-one |
|---|---|
| PubChem CID | 154475501 |
| Molecular Formula | C17H18F12O2 |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 6,6,6-trifluoro-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-methyl-5-(trifluoromethyl)hex-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H18F12O2/c1-8(2)11(30)7-12(14(18,19)20,15(21,22)23)9-3-5-10(6-4-9)13(31,16(24,25)26)17(27,28)29/h9-10,31H,1,3-7H2,2H3 |
| InChIKey | LUBVYLWKSQPONZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|