C12H14F9NO2 — CID 87772862
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide (PubChem CID 87772862) has the molecular formula C12H14F9NO2 and a molecular weight of 375.23 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87772862 |
| Molecular Formula | C12H14F9NO2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H14F9NO2/c13-9(14,15)5-22-8(23)6-1-3-7(4-2-6)10(24,11(16,17)18)12(19,20)21/h6-7,24H,1-5H2,(H,22,23) |
| InChIKey | WWEFPJPOZKUKRD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |