C11H19NO2 — CID 90499246
N-(2-cyclopropyl-2-hydroxypropyl)cyclobutanecarboxamide (PubChem CID 90499246) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxypropyl)cyclobutanecarboxamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxypropyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 90499246 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxypropyl)cyclobutanecarboxamide |
| SMILES | CC(O)(CNC(=O)C1CCC1)C1CC1 |
| InChI | InChI=1S/C11H19NO2/c1-11(14,9-5-6-9)7-12-10(13)8-3-2-4-8/h8-9,14H,2-7H2,1H3,(H,12,13) |
| InChIKey | TUDNGYORAYHFKE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |