C20H35N3O3 — CID 119048232
N-(2-cyclohexyl-2-hydroxypropyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide (PubChem CID 119048232) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-(2-cyclohexyl-2-hydroxypropyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-cyclohexyl-2-hydroxypropyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119048232 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | N-(2-cyclohexyl-2-hydroxypropyl)-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
| SMILES | CC(O)(CNC(=O)C1CCN(C(=O)N2CCCC2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C20H35N3O3/c1-20(26,17-7-3-2-4-8-17)15-21-18(24)16-9-13-23(14-10-16)19(25)22-11-5-6-12-22/h16-17,26H,2-15H2,1H3,(H,21,24) |
| InChIKey | CYFUHFZEBWLPMM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |