C20H37ClN4O2 — CID 119620505
N-[2-(cycloheptylamino)ethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119620505) has the molecular formula C20H37ClN4O2 and a molecular weight of 401.00 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119620505 |
| Molecular Formula | C20H37ClN4O2 |
| Molecular Weight | 401.00 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCNC1CCCCCC1)C1CCN(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H36N4O2.ClH/c25-19(22-12-11-21-18-7-3-1-2-4-8-18)17-9-15-24(16-10-17)20(26)23-13-5-6-14-23;/h17-18,21H,1-16H2,(H,22,25);1H |
| InChIKey | KBFKITYKSXPVBK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.00 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|