C10H20NO3+ — CID 142903075
1,1-dihydroxypropyl-dimethyl-(3-methyl-2-oxobut-3-enyl)azanium (PubChem CID 142903075) has the molecular formula C10H20NO3+ and a molecular weight of 202.27 g/mol. Its IUPAC name is 1,1-dihydroxypropyl-dimethyl-(3-methyl-2-oxobut-3-enyl)azanium.
| Compound Name | 1,1-dihydroxypropyl-dimethyl-(3-methyl-2-oxobut-3-enyl)azanium |
|---|---|
| PubChem CID | 142903075 |
| Molecular Formula | C10H20NO3+ |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1,1-dihydroxypropyl-dimethyl-(3-methyl-2-oxobut-3-enyl)azanium |
| SMILES | C=C(C)C(=O)C[N+](C)(C)C(O)(O)CC |
| InChI | InChI=1S/C10H20NO3/c1-6-10(13,14)11(4,5)7-9(12)8(2)3/h13-14H,2,6-7H2,1,3-5H3/q+1 |
| InChIKey | ZHNPIFPUSBSQNW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|