C6H16ClNO2 — CID 87060130
1,1-dihydroxypropyl(trimethyl)azanium chloride (PubChem CID 87060130) has the molecular formula C6H16ClNO2 and a molecular weight of 169.65 g/mol. Its IUPAC name is 1,1-dihydroxypropyl(trimethyl)azanium chloride.
| Compound Name | 1,1-dihydroxypropyl(trimethyl)azanium chloride |
|---|---|
| PubChem CID | 87060130 |
| Molecular Formula | C6H16ClNO2 |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1,1-dihydroxypropyl(trimethyl)azanium chloride |
| SMILES | CCC(O)(O)[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C6H16NO2.ClH/c1-5-6(8,9)7(2,3)4;/h8-9H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | CKKREDOXDNVBOM-UHFFFAOYSA-M |
| XLogP | -3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|