C15H28O3 — CID 89307508
4-[3-(hydroxymethyl)-3-methylpentoxy]-2,4-dimethylhex-1-en-3-one (PubChem CID 89307508) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)-3-methylpentoxy]-2,4-dimethylhex-1-en-3-one.
| Compound Name | 4-[3-(hydroxymethyl)-3-methylpentoxy]-2,4-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 89307508 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 4-[3-(hydroxymethyl)-3-methylpentoxy]-2,4-dimethylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(CC)OCCC(C)(CC)CO |
| InChI | InChI=1S/C15H28O3/c1-7-14(5,11-16)9-10-18-15(6,8-2)13(17)12(3)4/h16H,3,7-11H2,1-2,4-6H3 |
| InChIKey | CGSRIHPKXAGQTO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|