C33H33O16P — CID 139672802
tris(5-hydroxy-3,6-dioxo-4-prop-2-enoylocta-1,7-dien-4-yl) phosphate (PubChem CID 139672802) has the molecular formula C33H33O16P and a molecular weight of 716.58 g/mol. Its IUPAC name is tris(5-hydroxy-3,6-dioxo-4-prop-2-enoylocta-1,7-dien-4-yl) phosphate.
| Compound Name | tris(5-hydroxy-3,6-dioxo-4-prop-2-enoylocta-1,7-dien-4-yl) phosphate |
|---|---|
| PubChem CID | 139672802 |
| Molecular Formula | C33H33O16P |
| Molecular Weight | 716.58 g/mol |
| Exact Mass | 716.15 |
| IUPAC Name | tris(5-hydroxy-3,6-dioxo-4-prop-2-enoylocta-1,7-dien-4-yl) phosphate |
| SMILES | C=CC(=O)C(O)C(OP(=O)(OC(C(=O)C=C)(C(=O)C=C)C(O)C(=O)C=C)OC(C(=O)C=C)(C(=O)C=C)C(O)C(=O)C=C)(C(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C33H33O16P/c1-10-19(34)28(43)31(22(37)13-4,23(38)14-5)47-50(46,48-32(24(39)15-6,25(40)16-7)29(44)20(35)11-2)49-33(26(41)17-8,27(42)18-9)30(45)21(36)12-3/h10-18,28-30,43-45H,1-9H2 |
| InChIKey | CWPCIJDQVFRNDJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 259.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.58 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|