C30H51O4P — CID 21284660
tris(2,4,6-trimethylhepta-1,6-dien-4-yl) phosphate (PubChem CID 21284660) has the molecular formula C30H51O4P and a molecular weight of 506.71 g/mol. Its IUPAC name is tris(2,4,6-trimethylhepta-1,6-dien-4-yl) phosphate.
| Compound Name | tris(2,4,6-trimethylhepta-1,6-dien-4-yl) phosphate |
|---|---|
| PubChem CID | 21284660 |
| Molecular Formula | C30H51O4P |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | tris(2,4,6-trimethylhepta-1,6-dien-4-yl) phosphate |
| SMILES | C=C(C)CC(C)(CC(=C)C)OP(=O)(OC(C)(CC(=C)C)CC(=C)C)OC(C)(CC(=C)C)CC(=C)C |
| InChI | InChI=1S/C30H51O4P/c1-22(2)16-28(13,17-23(3)4)32-35(31,33-29(14,18-24(5)6)19-25(7)8)34-30(15,20-26(9)10)21-27(11)12/h1,3,5,7,9,11,16-21H2,2,4,6,8,10,12-15H3 |
| InChIKey | RISFSHTZABPOKS-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|