C13H24Cl6O8P2 — CID 175141651
bis(2-chloroethyl) (1,1-dichloro-3-methylbut-3-enyl) phosphate;bis(2-chloroethyl) hydrogen phosphate (PubChem CID 175141651) has the molecular formula C13H24Cl6O8P2 and a molecular weight of 582.99 g/mol. Its IUPAC name is bis(2-chloroethyl) (1,1-dichloro-3-methylbut-3-enyl) phosphate;bis(2-chloroethyl) hydrogen phosphate.
| Compound Name | bis(2-chloroethyl) (1,1-dichloro-3-methylbut-3-enyl) phosphate;bis(2-chloroethyl) hydrogen phosphate |
|---|---|
| PubChem CID | 175141651 |
| Molecular Formula | C13H24Cl6O8P2 |
| Molecular Weight | 582.99 g/mol |
| Exact Mass | 579.91 |
| IUPAC Name | bis(2-chloroethyl) (1,1-dichloro-3-methylbut-3-enyl) phosphate;bis(2-chloroethyl) hydrogen phosphate |
| SMILES | C=C(C)CC(Cl)(Cl)OP(=O)(OCCCl)OCCCl.O=P(O)(OCCCl)OCCCl |
| InChI | InChI=1S/C9H15Cl4O4P.C4H9Cl2O4P/c1-8(2)7-9(12,13)17-18(14,15-5-3-10)16-6-4-11;5-1-3-9-11(7,8)10-4-2-6/h1,3-7H2,2H3;1-4H2,(H,7,8) |
| InChIKey | JBDIANLNXQEZBE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.99 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|