About tris[2-(2-methylprop-2-enoxy)ethyl] phosphate
tris[2-(2-methylprop-2-enoxy)ethyl] phosphate (PubChem CID 87424877) has the molecular formula C18H33O7P
and a molecular weight of 392.43 g/mol. Its IUPAC name is tris[2-(2-methylprop-2-enoxy)ethyl] phosphate.
Molecular Properties
| Compound Name | tris[2-(2-methylprop-2-enoxy)ethyl] phosphate |
| PubChem CID | 87424877 |
| Molecular Formula | C18H33O7P |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | tris[2-(2-methylprop-2-enoxy)ethyl] phosphate |
| SMILES | C=C(C)COCCOP(=O)(OCCOCC(=C)C)OCCOCC(=C)C |
| InChI | InChI=1S/C18H33O7P/c1-16(2)13-20-7-10-23-26(19,24-11-8-21-14-17(3)4)25-12-9-22-15-18(5)6/h1,3,5,7-15H2,2,4,6H3 |
| InChIKey | YKVJNQABMYLQAP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[2-(2-methylprop-2-enoxy)ethyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[2-(2-methylprop-2-enoxy)ethyl] phosphate?
The IUPAC name of tris[2-(2-methylprop-2-enoxy)ethyl] phosphate (CID 87424877) is tris[2-(2-methylprop-2-enoxy)ethyl] phosphate.
What is the SMILES notation for tris[2-(2-methylprop-2-enoxy)ethyl] phosphate?
The canonical SMILES for tris[2-(2-methylprop-2-enoxy)ethyl] phosphate is C=C(C)COCCOP(=O)(OCCOCC(=C)C)OCCOCC(=C)C.
What is the InChIKey of tris[2-(2-methylprop-2-enoxy)ethyl] phosphate?
The InChIKey is YKVJNQABMYLQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33O7P/c1-16(2)13-20-7-10-23-26(19,24-11-8-21-14-17(3)4)25-12-9-22-15-18(5)6/h1,3,5,7-15H2,2,4,6H3.
What are the key properties of tris[2-(2-methylprop-2-enoxy)ethyl] phosphate?
tris[2-(2-methylprop-2-enoxy)ethyl] phosphate has a molecular weight of 392.43 g/mol, XLogP of 3.92, 18 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tris[2-(2-methylprop-2-enoxy)ethyl] phosphate is sourced from PubChem (CID 87424877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).