C20H36O7P2 — CID 23615474
bis(3-methylbut-3-enoxy)phosphoryl bis(3-methylbut-3-enyl) phosphate (PubChem CID 23615474) has the molecular formula C20H36O7P2 and a molecular weight of 450.45 g/mol. Its IUPAC name is bis(3-methylbut-3-enoxy)phosphoryl bis(3-methylbut-3-enyl) phosphate.
| Compound Name | bis(3-methylbut-3-enoxy)phosphoryl bis(3-methylbut-3-enyl) phosphate |
|---|---|
| PubChem CID | 23615474 |
| Molecular Formula | C20H36O7P2 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | bis(3-methylbut-3-enoxy)phosphoryl bis(3-methylbut-3-enyl) phosphate |
| SMILES | C=C(C)CCOP(=O)(OCCC(=C)C)OP(=O)(OCCC(=C)C)OCCC(=C)C |
| InChI | InChI=1S/C20H36O7P2/c1-17(2)9-13-23-28(21,24-14-10-18(3)4)27-29(22,25-15-11-19(5)6)26-16-12-20(7)8/h1,3,5,7,9-16H2,2,4,6,8H3 |
| InChIKey | QUGXIRJGKGNLON-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|