C11H18O13P2 — CID 88501862
1-[hydroxy-[hydroxy(3-methylbut-3-enoxy)phosphoryl]oxyphosphoryl]oxypropane-1,2,3-tricarboxylic acid (PubChem CID 88501862) has the molecular formula C11H18O13P2 and a molecular weight of 420.20 g/mol. Its IUPAC name is 1-[hydroxy-[hydroxy(3-methylbut-3-enoxy)phosphoryl]oxyphosphoryl]oxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-[hydroxy-[hydroxy(3-methylbut-3-enoxy)phosphoryl]oxyphosphoryl]oxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 88501862 |
| Molecular Formula | C11H18O13P2 |
| Molecular Weight | 420.20 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 1-[hydroxy-[hydroxy(3-methylbut-3-enoxy)phosphoryl]oxyphosphoryl]oxypropane-1,2,3-tricarboxylic acid |
| SMILES | C=C(C)CCOP(=O)(O)OP(=O)(O)OC(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18O13P2/c1-6(2)3-4-22-25(18,19)24-26(20,21)23-9(11(16)17)7(10(14)15)5-8(12)13/h7,9H,1,3-5H2,2H3,(H,12,13)(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | HFQDQDFHDDSDBQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 214.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|