C5H10O8P2-2 — CID 135057894
[3-methylbut-3-enoxy(oxido)phosphoryl]oxy hydrogen phosphate (PubChem CID 135057894) has the molecular formula C5H10O8P2-2 and a molecular weight of 260.07 g/mol. Its IUPAC name is [3-methylbut-3-enoxy(oxido)phosphoryl]oxy hydrogen phosphate.
| Compound Name | [3-methylbut-3-enoxy(oxido)phosphoryl]oxy hydrogen phosphate |
|---|---|
| PubChem CID | 135057894 |
| Molecular Formula | C5H10O8P2-2 |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | [3-methylbut-3-enoxy(oxido)phosphoryl]oxy hydrogen phosphate |
| SMILES | C=C(C)CCOP(=O)([O-])OOP(=O)([O-])O |
| InChI | InChI=1S/C5H12O8P2/c1-5(2)3-4-11-15(9,10)13-12-14(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8)/p-2 |
| InChIKey | FHYIQPVJXVQOFH-UHFFFAOYSA-L |
| XLogP | -0.15 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|