C5H9O6P2-3 — CID 153279870
3-methylbut-3-enoxy(phosphonato)phosphinate (PubChem CID 153279870) has the molecular formula C5H9O6P2-3 and a molecular weight of 227.07 g/mol. Its IUPAC name is 3-methylbut-3-enoxy(phosphonato)phosphinate.
| Compound Name | 3-methylbut-3-enoxy(phosphonato)phosphinate |
|---|---|
| PubChem CID | 153279870 |
| Molecular Formula | C5H9O6P2-3 |
| Molecular Weight | 227.07 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 3-methylbut-3-enoxy(phosphonato)phosphinate |
| SMILES | C=C(C)CCOP(=O)([O-])P(=O)([O-])[O-] |
| InChI | InChI=1S/C5H12O6P2/c1-5(2)3-4-11-13(9,10)12(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8)/p-3 |
| InChIKey | YQNYUKKBTXODEC-UHFFFAOYSA-K |
| XLogP | -0.65 |
| TPSA | 112.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.07 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|