About sodium phosphonooxy hydrogen phosphate
sodium phosphonooxy hydrogen phosphate (PubChem CID 159276907) has the molecular formula H3NaO8P2
and a molecular weight of 215.95 g/mol. Its IUPAC name is sodium phosphonooxy hydrogen phosphate.
Molecular Properties
| Compound Name | sodium phosphonooxy hydrogen phosphate |
| PubChem CID | 159276907 |
| Molecular Formula | H3NaO8P2 |
| Molecular Weight | 215.95 g/mol |
| Exact Mass | 215.92 |
| IUPAC Name | sodium phosphonooxy hydrogen phosphate |
| SMILES | O=P([O-])(O)OOP(=O)(O)O.[Na+] |
| InChI | InChI=1S/Na.H4O8P2/c;1-9(2,3)7-8-10(4,5)6/h;(H2,1,2,3)(H2,4,5,6)/q+1;/p-1 |
| InChIKey | KYKQNQCQBFHEKJ-UHFFFAOYSA-M |
| XLogP | -4.51 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.95 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium phosphonooxy hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium phosphonooxy hydrogen phosphate?
The IUPAC name of sodium phosphonooxy hydrogen phosphate (CID 159276907) is sodium phosphonooxy hydrogen phosphate.
What is the SMILES notation for sodium phosphonooxy hydrogen phosphate?
The canonical SMILES for sodium phosphonooxy hydrogen phosphate is O=P([O-])(O)OOP(=O)(O)O.[Na+].
What is the InChIKey of sodium phosphonooxy hydrogen phosphate?
The InChIKey is KYKQNQCQBFHEKJ-UHFFFAOYSA-M. The full InChI is InChI=1S/Na.H4O8P2/c;1-9(2,3)7-8-10(4,5)6/h;(H2,1,2,3)(H2,4,5,6)/q+1;/p-1.
What are the key properties of sodium phosphonooxy hydrogen phosphate?
sodium phosphonooxy hydrogen phosphate has a molecular weight of 215.95 g/mol, XLogP of -4.51, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium phosphonooxy hydrogen phosphate is sourced from PubChem (CID 159276907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).