H5CrO14P4 — CID 175898917
chromium(3+);[hydroxy(oxido)phosphoryl] phosphate;phosphono dihydrogen phosphate (PubChem CID 175898917) has the molecular formula H5CrO14P4 and a molecular weight of 404.92 g/mol. Its IUPAC name is chromium(3+);[hydroxy(oxido)phosphoryl] phosphate;phosphono dihydrogen phosphate.
| Compound Name | chromium(3+);[hydroxy(oxido)phosphoryl] phosphate;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 175898917 |
| Molecular Formula | H5CrO14P4 |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.80 |
| IUPAC Name | chromium(3+);[hydroxy(oxido)phosphoryl] phosphate;phosphono dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O.O=P([O-])([O-])OP(=O)([O-])O.[Cr+3] |
| InChI | InChI=1S/Cr.2H4O7P2/c;2*1-8(2,3)7-9(4,5)6/h;2*(H2,1,2,3)(H2,4,5,6)/q+3;;/p-3 |
| InChIKey | SUSLDZZOABWYHF-UHFFFAOYSA-K |
| XLogP | -3.52 |
| TPSA | 257.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|