H3ClCuO7P2 — CID 175231033
copper;phosphono hydrogen phosphate;chloride (PubChem CID 175231033) has the molecular formula H3ClCuO7P2 and a molecular weight of 275.96 g/mol. Its IUPAC name is copper;phosphono hydrogen phosphate;chloride.
| Compound Name | copper;phosphono hydrogen phosphate;chloride |
|---|---|
| PubChem CID | 175231033 |
| Molecular Formula | H3ClCuO7P2 |
| Molecular Weight | 275.96 g/mol |
| Exact Mass | 274.83 |
| IUPAC Name | copper;phosphono hydrogen phosphate;chloride |
| SMILES | O=P([O-])(O)OP(=O)(O)O.[Cl-].[Cu+2] |
| InChI | InChI=1S/ClH.Cu.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h1H;;(H2,1,2,3)(H2,4,5,6)/q;+2;/p-2 |
| InChIKey | FMWXOTNOVBRGDO-UHFFFAOYSA-L |
| XLogP | -4.44 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.96 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|