H4CuO11P2S — CID 175344520
copper;phosphono phosphate;sulfuric acid (PubChem CID 175344520) has the molecular formula H4CuO11P2S and a molecular weight of 337.58 g/mol. Its IUPAC name is copper;phosphono phosphate;sulfuric acid.
| Compound Name | copper;phosphono phosphate;sulfuric acid |
|---|---|
| PubChem CID | 175344520 |
| Molecular Formula | H4CuO11P2S |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 336.82 |
| IUPAC Name | copper;phosphono phosphate;sulfuric acid |
| SMILES | O=P([O-])([O-])OP(=O)(O)O.O=S(=O)(O)O.[Cu+2] |
| InChI | InChI=1S/Cu.H4O7P2.H2O4S/c;1-8(2,3)7-9(4,5)6;1-5(2,3)4/h;(H2,1,2,3)(H2,4,5,6);(H2,1,2,3,4)/q+2;;/p-2 |
| InChIKey | ZDIBDCNCHWXCDJ-UHFFFAOYSA-L |
| XLogP | -2.73 |
| TPSA | 204.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|