C26H40O8 — CID 162815713
1-(16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propane-1,2,3-tricarboxylic acid (PubChem CID 162815713) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-(16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propane-1,2,3-tricarboxylic acid.
| Compound Name | 1-(16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 162815713 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 1-(16-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propane-1,2,3-tricarboxylic acid |
| SMILES | CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOC(C(=O)O)C(CC(=O)O)C(=O)O)CO |
| InChI | InChI=1S/C26H40O8/c1-18(8-5-9-19(2)11-7-13-21(4)17-27)10-6-12-20(3)14-15-34-24(26(32)33)22(25(30)31)16-23(28)29/h9-10,13-14,22,24,27H,5-8,11-12,15-17H2,1-4H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | LJSMEPMKRGALRR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|