C34H54O6 — CID 173348378
[12-(1-acetyloxy-12-hydroxy-2,6,10-trimethyldodeca-2,6,10-trienoxy)-2,6,10-trimethyldodeca-2,6,10-trienyl] acetate (PubChem CID 173348378) has the molecular formula C34H54O6 and a molecular weight of 558.80 g/mol. Its IUPAC name is [12-(1-acetyloxy-12-hydroxy-2,6,10-trimethyldodeca-2,6,10-trienoxy)-2,6,10-trimethyldodeca-2,6,10-trienyl] acetate.
| Compound Name | [12-(1-acetyloxy-12-hydroxy-2,6,10-trimethyldodeca-2,6,10-trienoxy)-2,6,10-trimethyldodeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 173348378 |
| Molecular Formula | C34H54O6 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | [12-(1-acetyloxy-12-hydroxy-2,6,10-trimethyldodeca-2,6,10-trienoxy)-2,6,10-trimethyldodeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OCC(C)=CCCC(C)=CCCC(C)=CCOC(OC(C)=O)C(C)=CCCC(C)=CCCC(C)=CCO |
| InChI | InChI=1S/C34H54O6/c1-26(15-11-19-30(5)25-39-32(7)36)14-10-17-29(4)22-24-38-34(40-33(8)37)31(6)20-12-18-27(2)13-9-16-28(3)21-23-35/h13-14,19-22,34-35H,9-12,15-18,23-25H2,1-8H3 |
| InChIKey | YWGYOSLOFRKYJG-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|