C12H20O3 — CID 12648855
2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetic acid (PubChem CID 12648855) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetic acid.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetic acid |
|---|---|
| PubChem CID | 12648855 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetic acid |
| SMILES | CC(C)=CCC/C(C)=C/COCC(=O)O |
| InChI | InChI=1S/C12H20O3/c1-10(2)5-4-6-11(3)7-8-15-9-12(13)14/h5,7H,4,6,8-9H2,1-3H3,(H,13,14)/b11-7+ |
| InChIKey | UGLQHPOVQTWRPN-YRNVUSSQSA-N |
| XLogP | 2.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|