C30H48O5 — CID 160909322
2-[2-oxo-2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenoxy]ethoxy]acetic acid (PubChem CID 160909322) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is 2-[2-oxo-2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 160909322 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 2-[2-oxo-2-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenoxy]ethoxy]acetic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCOC(=O)COCC(=O)O |
| InChI | InChI=1S/C30H48O5/c1-24(2)12-9-15-27(5)18-10-16-25(3)13-7-8-14-26(4)17-11-19-28(6)20-21-35-30(33)23-34-22-29(31)32/h12-14,18-19H,7-11,15-17,20-23H2,1-6H3,(H,31,32)/b25-13+,26-14+,27-18+,28-19+ |
| InChIKey | RGYUDWOQLUDUQE-QOEMZADFSA-N |
| XLogP | 7.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|