C28H38O8 — CID 72763582
4-[16-(3-carboxyprop-2-enoyloxy)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid (PubChem CID 72763582) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is 4-[16-(3-carboxyprop-2-enoyloxy)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[16-(3-carboxyprop-2-enoyloxy)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 72763582 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 4-[16-(3-carboxyprop-2-enoyloxy)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid |
| SMILES | CC(=CCCC(C)=CCOC(=O)C=CC(=O)O)CCC=C(C)CCC=C(C)COC(=O)C=CC(=O)O |
| InChI | InChI=1S/C28H38O8/c1-21(10-6-12-23(3)18-19-35-27(33)16-14-25(29)30)8-5-9-22(2)11-7-13-24(4)20-36-28(34)17-15-26(31)32/h9-10,13-18H,5-8,11-12,19-20H2,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | AHOSPPOAEYRVLQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|