C10H21NO6P+ — CID 143475819
2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethylazanium (PubChem CID 143475819) has the molecular formula C10H21NO6P+ and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethylazanium.
| Compound Name | 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethylazanium |
|---|---|
| PubChem CID | 143475819 |
| Molecular Formula | C10H21NO6P+ |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl-dimethylazanium |
| SMILES | C=C(C)C(=O)OCCOP(=O)(O)OCC[NH+](C)C |
| InChI | InChI=1S/C10H20NO6P/c1-9(2)10(12)15-7-8-17-18(13,14)16-6-5-11(3)4/h1,5-8H2,2-4H3,(H,13,14)/p+1 |
| InChIKey | XAMNQEGHJKXNDA-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|