About 2-hydroxypropyl(trimethyl)azanium;octadecanoate
2-hydroxypropyl(trimethyl)azanium;octadecanoate (PubChem CID 141310032) has the molecular formula C24H51NO3
and a molecular weight of 401.68 g/mol. Its IUPAC name is 2-hydroxypropyl(trimethyl)azanium;octadecanoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl(trimethyl)azanium;octadecanoate |
| PubChem CID | 141310032 |
| Molecular Formula | C24H51NO3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.39 |
| IUPAC Name | 2-hydroxypropyl(trimethyl)azanium;octadecanoate |
| SMILES | CC(O)C[N+](C)(C)C.CCCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H36O2.C6H16NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6(8)5-7(2,3)4/h2-17H2,1H3,(H,19,20);6,8H,5H2,1-4H3/q;+1/p-1 |
| InChIKey | GCJFTVLUZXUAKO-UHFFFAOYSA-M |
| XLogP | 5.07 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl(trimethyl)azanium;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl(trimethyl)azanium;octadecanoate?
The IUPAC name of 2-hydroxypropyl(trimethyl)azanium;octadecanoate (CID 141310032) is 2-hydroxypropyl(trimethyl)azanium;octadecanoate.
What is the SMILES notation for 2-hydroxypropyl(trimethyl)azanium;octadecanoate?
The canonical SMILES for 2-hydroxypropyl(trimethyl)azanium;octadecanoate is CC(O)C[N+](C)(C)C.CCCCCCCCCCCCCCCCCC(=O)[O-].
What is the InChIKey of 2-hydroxypropyl(trimethyl)azanium;octadecanoate?
The InChIKey is GCJFTVLUZXUAKO-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.C6H16NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6(8)5-7(2,3)4/h2-17H2,1H3,(H,19,20);6,8H,5H2,1-4H3/q;+1/p-1.
What are the key properties of 2-hydroxypropyl(trimethyl)azanium;octadecanoate?
2-hydroxypropyl(trimethyl)azanium;octadecanoate has a molecular weight of 401.68 g/mol, XLogP of 5.07, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl(trimethyl)azanium;octadecanoate is sourced from PubChem (CID 141310032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).