About bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate
bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate (PubChem CID 130404727) has the molecular formula C52H108N2O6
and a molecular weight of 857.44 g/mol. Its IUPAC name is bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate.
Molecular Properties
| Compound Name | bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate |
| PubChem CID | 130404727 |
| Molecular Formula | C52H108N2O6 |
| Molecular Weight | 857.44 g/mol |
| Exact Mass | 856.82 |
| IUPAC Name | bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate |
| SMILES | CCCCCCCCCC[N+](C)(CCCCCCCCCC)C(C)O.CCCCCCCCCC[N+](C)(CCCCCCCCCC)C(C)O.O=C([O-])CCCCC(=O)[O-] |
| InChI | InChI=1S/2C23H50NO.C6H10O4/c2*1-5-7-9-11-13-15-17-19-21-24(4,23(3)25)22-20-18-16-14-12-10-8-6-2;7-5(8)3-1-2-4-6(9)10/h2*23,25H,5-22H2,1-4H3;1-4H2,(H,7,8)(H,9,10)/q2*+1;/p-2 |
| InChIKey | CWVXPYRKTYOBBN-UHFFFAOYSA-L |
| XLogP | 12.15 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 857.44 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate?
The IUPAC name of bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate (CID 130404727) is bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate.
What is the SMILES notation for bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate?
The canonical SMILES for bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate is CCCCCCCCCC[N+](C)(CCCCCCCCCC)C(C)O.CCCCCCCCCC[N+](C)(CCCCCCCCCC)C(C)O.O=C([O-])CCCCC(=O)[O-].
What is the InChIKey of bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate?
The InChIKey is CWVXPYRKTYOBBN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C23H50NO.C6H10O4/c2*1-5-7-9-11-13-15-17-19-21-24(4,23(3)25)22-20-18-16-14-12-10-8-6-2;7-5(8)3-1-2-4-6(9)10/h2*23,25H,5-22H2,1-4H3;1-4H2,(H,7,8)(H,9,10)/q2*+1;/p-2.
What are the key properties of bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate?
bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate has a molecular weight of 857.44 g/mol, XLogP of 12.15, 43 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(didecyl-(1-hydroxyethyl)-methylazanium);hexanedioate is sourced from PubChem (CID 130404727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).