About hexanoate;tris(propan-2-ol);zirconium
hexanoate;tris(propan-2-ol);zirconium (PubChem CID 87234011) has the molecular formula C15H35O5Zr-
and a molecular weight of 386.66 g/mol. Its IUPAC name is hexanoate;tris(propan-2-ol);zirconium.
Molecular Properties
| Compound Name | hexanoate;tris(propan-2-ol);zirconium |
| PubChem CID | 87234011 |
| Molecular Formula | C15H35O5Zr- |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | hexanoate;tris(propan-2-ol);zirconium |
| SMILES | CC(C)O.CC(C)O.CC(C)O.CCCCCC(=O)[O-].[Zr] |
| InChI | InChI=1S/C6H12O2.3C3H8O.Zr/c1-2-3-4-5-6(7)8;3*1-3(2)4;/h2-5H2,1H3,(H,7,8);3*3-4H,1-2H3;/p-1 |
| InChIKey | BTXIVPASBLFBJY-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanoate;tris(propan-2-ol);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoate;tris(propan-2-ol);zirconium?
The IUPAC name of hexanoate;tris(propan-2-ol);zirconium (CID 87234011) is hexanoate;tris(propan-2-ol);zirconium.
What is the SMILES notation for hexanoate;tris(propan-2-ol);zirconium?
The canonical SMILES for hexanoate;tris(propan-2-ol);zirconium is CC(C)O.CC(C)O.CC(C)O.CCCCCC(=O)[O-].[Zr].
What is the InChIKey of hexanoate;tris(propan-2-ol);zirconium?
The InChIKey is BTXIVPASBLFBJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O2.3C3H8O.Zr/c1-2-3-4-5-6(7)8;3*1-3(2)4;/h2-5H2,1H3,(H,7,8);3*3-4H,1-2H3;/p-1.
What are the key properties of hexanoate;tris(propan-2-ol);zirconium?
hexanoate;tris(propan-2-ol);zirconium has a molecular weight of 386.66 g/mol, XLogP of 1.48, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoate;tris(propan-2-ol);zirconium is sourced from PubChem (CID 87234011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).