About 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate
2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate (PubChem CID 86734985) has the molecular formula C16H35NO3
and a molecular weight of 289.46 g/mol. Its IUPAC name is 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate |
| PubChem CID | 86734985 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate |
| SMILES | CC(C)CCCCCCC(=O)[O-].CC(O)C[N+](C)(C)C |
| InChI | InChI=1S/C10H20O2.C6H16NO/c1-9(2)7-5-3-4-6-8-10(11)12;1-6(8)5-7(2,3)4/h9H,3-8H2,1-2H3,(H,11,12);6,8H,5H2,1-4H3/q;+1/p-1 |
| InChIKey | YBDJLUDNJYPDJT-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate?
The IUPAC name of 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate (CID 86734985) is 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate.
What is the SMILES notation for 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate?
The canonical SMILES for 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate is CC(C)CCCCCCC(=O)[O-].CC(O)C[N+](C)(C)C.
What is the InChIKey of 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate?
The InChIKey is YBDJLUDNJYPDJT-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2.C6H16NO/c1-9(2)7-5-3-4-6-8-10(11)12;1-6(8)5-7(2,3)4/h9H,3-8H2,1-2H3,(H,11,12);6,8H,5H2,1-4H3/q;+1/p-1.
What are the key properties of 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate?
2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate has a molecular weight of 289.46 g/mol, XLogP of 1.81, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl(trimethyl)azanium;8-methylnonanoate is sourced from PubChem (CID 86734985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).