About diethyl-(methoxymethyl)-methylazanium;propanoate
diethyl-(methoxymethyl)-methylazanium;propanoate (PubChem CID 140577543) has the molecular formula C10H23NO3
and a molecular weight of 205.30 g/mol. Its IUPAC name is diethyl-(methoxymethyl)-methylazanium;propanoate.
Molecular Properties
| Compound Name | diethyl-(methoxymethyl)-methylazanium;propanoate |
| PubChem CID | 140577543 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | diethyl-(methoxymethyl)-methylazanium;propanoate |
| SMILES | CCC(=O)[O-].CC[N+](C)(CC)COC |
| InChI | InChI=1S/C7H18NO.C3H6O2/c1-5-8(3,6-2)7-9-4;1-2-3(4)5/h5-7H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | PZHZYBYWOTZEKR-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-(methoxymethyl)-methylazanium;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-(methoxymethyl)-methylazanium;propanoate?
The IUPAC name of diethyl-(methoxymethyl)-methylazanium;propanoate (CID 140577543) is diethyl-(methoxymethyl)-methylazanium;propanoate.
What is the SMILES notation for diethyl-(methoxymethyl)-methylazanium;propanoate?
The canonical SMILES for diethyl-(methoxymethyl)-methylazanium;propanoate is CCC(=O)[O-].CC[N+](C)(CC)COC.
What is the InChIKey of diethyl-(methoxymethyl)-methylazanium;propanoate?
The InChIKey is PZHZYBYWOTZEKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H18NO.C3H6O2/c1-5-8(3,6-2)7-9-4;1-2-3(4)5/h5-7H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of diethyl-(methoxymethyl)-methylazanium;propanoate?
diethyl-(methoxymethyl)-methylazanium;propanoate has a molecular weight of 205.30 g/mol, XLogP of 0.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-(methoxymethyl)-methylazanium;propanoate is sourced from PubChem (CID 140577543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).