About pentanoate;triethyl(methoxymethyl)azanium
pentanoate;triethyl(methoxymethyl)azanium (PubChem CID 140577540) has the molecular formula C13H29NO3
and a molecular weight of 247.38 g/mol. Its IUPAC name is pentanoate;triethyl(methoxymethyl)azanium.
Molecular Properties
| Compound Name | pentanoate;triethyl(methoxymethyl)azanium |
| PubChem CID | 140577540 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | pentanoate;triethyl(methoxymethyl)azanium |
| SMILES | CCCCC(=O)[O-].CC[N+](CC)(CC)COC |
| InChI | InChI=1S/C8H20NO.C5H10O2/c1-5-9(6-2,7-3)8-10-4;1-2-3-4-5(6)7/h5-8H2,1-4H3;2-4H2,1H3,(H,6,7)/q+1;/p-1 |
| InChIKey | IUJXFLZUCKPSFI-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze pentanoate;triethyl(methoxymethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoate;triethyl(methoxymethyl)azanium?
The IUPAC name of pentanoate;triethyl(methoxymethyl)azanium (CID 140577540) is pentanoate;triethyl(methoxymethyl)azanium.
What is the SMILES notation for pentanoate;triethyl(methoxymethyl)azanium?
The canonical SMILES for pentanoate;triethyl(methoxymethyl)azanium is CCCCC(=O)[O-].CC[N+](CC)(CC)COC.
What is the InChIKey of pentanoate;triethyl(methoxymethyl)azanium?
The InChIKey is IUJXFLZUCKPSFI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20NO.C5H10O2/c1-5-9(6-2,7-3)8-10-4;1-2-3-4-5(6)7/h5-8H2,1-4H3;2-4H2,1H3,(H,6,7)/q+1;/p-1.
What are the key properties of pentanoate;triethyl(methoxymethyl)azanium?
pentanoate;triethyl(methoxymethyl)azanium has a molecular weight of 247.38 g/mol, XLogP of 1.39, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoate;triethyl(methoxymethyl)azanium is sourced from PubChem (CID 140577540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).