About ethoxymethyl(trimethyl)azanium;pentanoate
ethoxymethyl(trimethyl)azanium;pentanoate (PubChem CID 87071250) has the molecular formula C11H25NO3
and a molecular weight of 219.32 g/mol. Its IUPAC name is ethoxymethyl(trimethyl)azanium;pentanoate.
Molecular Properties
| Compound Name | ethoxymethyl(trimethyl)azanium;pentanoate |
| PubChem CID | 87071250 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | ethoxymethyl(trimethyl)azanium;pentanoate |
| SMILES | CCCCC(=O)[O-].CCOC[N+](C)(C)C |
| InChI | InChI=1S/C6H16NO.C5H10O2/c1-5-8-6-7(2,3)4;1-2-3-4-5(6)7/h5-6H2,1-4H3;2-4H2,1H3,(H,6,7)/q+1;/p-1 |
| InChIKey | MDSKPHFQAGWSFJ-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethoxymethyl(trimethyl)azanium;pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethyl(trimethyl)azanium;pentanoate?
The IUPAC name of ethoxymethyl(trimethyl)azanium;pentanoate (CID 87071250) is ethoxymethyl(trimethyl)azanium;pentanoate.
What is the SMILES notation for ethoxymethyl(trimethyl)azanium;pentanoate?
The canonical SMILES for ethoxymethyl(trimethyl)azanium;pentanoate is CCCCC(=O)[O-].CCOC[N+](C)(C)C.
What is the InChIKey of ethoxymethyl(trimethyl)azanium;pentanoate?
The InChIKey is MDSKPHFQAGWSFJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16NO.C5H10O2/c1-5-8-6-7(2,3)4;1-2-3-4-5(6)7/h5-6H2,1-4H3;2-4H2,1H3,(H,6,7)/q+1;/p-1.
What are the key properties of ethoxymethyl(trimethyl)azanium;pentanoate?
ethoxymethyl(trimethyl)azanium;pentanoate has a molecular weight of 219.32 g/mol, XLogP of 0.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethyl(trimethyl)azanium;pentanoate is sourced from PubChem (CID 87071250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).